C13H15NO2S — CID 139885156
6-methylsulfanyl-1-(2-oxopropyl)-3,4-dihydroquinolin-2-one (PubChem CID 139885156) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 6-methylsulfanyl-1-(2-oxopropyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-methylsulfanyl-1-(2-oxopropyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 139885156 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 6-methylsulfanyl-1-(2-oxopropyl)-3,4-dihydroquinolin-2-one |
| SMILES | CSc1ccc2c(c1)CCC(=O)N2CC(C)=O |
| InChI | InChI=1S/C13H15NO2S/c1-9(15)8-14-12-5-4-11(17-2)7-10(12)3-6-13(14)16/h4-5,7H,3,6,8H2,1-2H3 |
| InChIKey | IAJVNSMLFBVSPN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |