C17H21N3O — CID 139886434
N-[4-[3-(2-aminoethyl)-4,6-dimethyl-2-pyridinyl]phenyl]acetamide (PubChem CID 139886434) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is N-[4-[3-(2-aminoethyl)-4,6-dimethyl-2-pyridinyl]phenyl]acetamide.
| Compound Name | N-[4-[3-(2-aminoethyl)-4,6-dimethyl-2-pyridinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139886434 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[4-[3-(2-aminoethyl)-4,6-dimethyl-2-pyridinyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2nc(C)cc(C)c2CCN)cc1 |
| InChI | InChI=1S/C17H21N3O/c1-11-10-12(2)19-17(16(11)8-9-18)14-4-6-15(7-5-14)20-13(3)21/h4-7,10H,8-9,18H2,1-3H3,(H,20,21) |
| InChIKey | GIEPSOFSKPYLOQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |