About [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate
[methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139886940) has the molecular formula C14H13F3O4S2
and a molecular weight of 366.38 g/mol. Its IUPAC name is [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| PubChem CID | 139886940 |
| Molecular Formula | C14H13F3O4S2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | COS(OS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13F3O4S2/c1-20-22(12-8-4-2-5-9-12,13-10-6-3-7-11-13)21-23(18,19)14(15,16)17/h2-11H,1H3 |
| InChIKey | QVSSOLZZTFNJNM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The IUPAC name of [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate (CID 139886940) is [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
What is the SMILES notation for [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The canonical SMILES for [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate is COS(OS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The InChIKey is QVSSOLZZTFNJNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3O4S2/c1-20-22(12-8-4-2-5-9-12,13-10-6-3-7-11-13)21-23(18,19)14(15,16)17/h2-11H,1H3.
What are the key properties of [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
[methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate has a molecular weight of 366.38 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [methoxy(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate is sourced from PubChem (CID 139886940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).