C16H25NO6S — CID 139887294
[(2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] methanesulfonate (PubChem CID 139887294) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is [(2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] methanesulfonate.
| Compound Name | [(2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] methanesulfonate |
|---|---|
| PubChem CID | 139887294 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [(2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)COS(C)(=O)=O |
| InChI | InChI=1S/C16H25NO6S/c1-16(2,3)23-15(19)17-13(10-12-8-6-5-7-9-12)14(18)11-22-24(4,20)21/h5-9,13-14,18H,10-11H2,1-4H3,(H,17,19)/t13-,14+/m0/s1 |
| InChIKey | UKDNURHNFMSCHJ-UONOGXRCSA-N |
| XLogP | 1.46 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|