C20H27N5 — CID 139887316
N-(2-benzylcyclopentyl)-4-(ethylideneamino)-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 139887316) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-(2-benzylcyclopentyl)-4-(ethylideneamino)-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(2-benzylcyclopentyl)-4-(ethylideneamino)-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 139887316 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-(2-benzylcyclopentyl)-4-(ethylideneamino)-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC=Nc1nc(NC2CCCC2Cc2ccccc2)nc(C(C)C)n1 |
| InChI | InChI=1S/C20H27N5/c1-4-21-19-23-18(14(2)3)24-20(25-19)22-17-12-8-11-16(17)13-15-9-6-5-7-10-15/h4-7,9-10,14,16-17H,8,11-13H2,1-3H3,(H,22,23,24,25) |
| InChIKey | BIIBPMQCQQQMBS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|