C100H82O4Si4 — CID 139887823
triphenyl-[4-[1,4,4-tris(4-triphenylsilyloxyphenyl)butyl]phenoxy]silane (PubChem CID 139887823) has the molecular formula C100H82O4Si4 and a molecular weight of 1460.10 g/mol. Its IUPAC name is triphenyl-[4-[1,4,4-tris(4-triphenylsilyloxyphenyl)butyl]phenoxy]silane.
| Compound Name | triphenyl-[4-[1,4,4-tris(4-triphenylsilyloxyphenyl)butyl]phenoxy]silane |
|---|---|
| PubChem CID | 139887823 |
| Molecular Formula | C100H82O4Si4 |
| Molecular Weight | 1460.10 g/mol |
| Exact Mass | 1458.53 |
| IUPAC Name | triphenyl-[4-[1,4,4-tris(4-triphenylsilyloxyphenyl)butyl]phenoxy]silane |
| SMILES | c1ccc([Si](Oc2ccc(C(CCC(c3ccc(O[Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c3ccc(O[Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c3ccc(O[Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C100H82O4Si4/c1-13-37-87(38-14-1)105(88-39-15-2-16-40-88,89-41-17-3-18-42-89)101-83-69-61-79(62-70-83)99(80-63-71-84(72-64-80)102-106(90-43-19-4-20-44-90,91-45-21-5-22-46-91)92-47-23-6-24-48-92)77-78-100(81-65-73-85(74-66-81)103-107(93-49-25-7-26-50-93,94-51-27-8-28-52-94)95-53-29-9-30-54-95)82-67-75-86(76-68-82)104-108(96-55-31-10-32-56-96,97-57-33-11-34-58-97)98-59-35-12-36-60-98/h1-76,99-100H,77-78H2 |
| InChIKey | GBUAKPCMRMCXSX-UHFFFAOYSA-N |
| XLogP | 15.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 108 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1460.10 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|