C16H14N2O3 — CID 139888147
5-[(2-methoxynaphthalen-1-yl)methylidene]-1-methylimidazolidine-2,4-dione (PubChem CID 139888147) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-[(2-methoxynaphthalen-1-yl)methylidene]-1-methylimidazolidine-2,4-dione.
| Compound Name | 5-[(2-methoxynaphthalen-1-yl)methylidene]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139888147 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-[(2-methoxynaphthalen-1-yl)methylidene]-1-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc2ccccc2c1C=C1C(=O)NC(=O)N1C |
| InChI | InChI=1S/C16H14N2O3/c1-18-13(15(19)17-16(18)20)9-12-11-6-4-3-5-10(11)7-8-14(12)21-2/h3-9H,1-2H3,(H,17,19,20) |
| InChIKey | DTQYQRALRHMMQC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|