C24H40N2Si2 — CID 139888654
(1R,2R)-N,N,N',N'-tetramethyl-1,2-bis(2-trimethylsilylphenyl)ethane-1,2-diamine (PubChem CID 139888654) has the molecular formula C24H40N2Si2 and a molecular weight of 412.77 g/mol. Its IUPAC name is (1R,2R)-N,N,N',N'-tetramethyl-1,2-bis(2-trimethylsilylphenyl)ethane-1,2-diamine.
| Compound Name | (1R,2R)-N,N,N',N'-tetramethyl-1,2-bis(2-trimethylsilylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 139888654 |
| Molecular Formula | C24H40N2Si2 |
| Molecular Weight | 412.77 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | (1R,2R)-N,N,N',N'-tetramethyl-1,2-bis(2-trimethylsilylphenyl)ethane-1,2-diamine |
| SMILES | CN(C)[C@H](c1ccccc1[Si](C)(C)C)[C@@H](c1ccccc1[Si](C)(C)C)N(C)C |
| InChI | InChI=1S/C24H40N2Si2/c1-25(2)23(19-15-11-13-17-21(19)27(5,6)7)24(26(3)4)20-16-12-14-18-22(20)28(8,9)10/h11-18,23-24H,1-10H3/t23-,24-/m1/s1 |
| InChIKey | LOOLKUCEVKOFOU-DNQXCXABSA-N |
| XLogP | 4.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|