About 1,1-diethoxy-2,4-di(propan-2-yl)siletane
1,1-diethoxy-2,4-di(propan-2-yl)siletane (PubChem CID 139888756) has the molecular formula C13H28O2Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is 1,1-diethoxy-2,4-di(propan-2-yl)siletane.
Molecular Properties
| Compound Name | 1,1-diethoxy-2,4-di(propan-2-yl)siletane |
| PubChem CID | 139888756 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1,1-diethoxy-2,4-di(propan-2-yl)siletane |
| SMILES | CCO[Si]1(OCC)C(C(C)C)CC1C(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-7-14-16(15-8-2)12(10(3)4)9-13(16)11(5)6/h10-13H,7-9H2,1-6H3 |
| InChIKey | BRPKUDWZWWDQLV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxy-2,4-di(propan-2-yl)siletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxy-2,4-di(propan-2-yl)siletane?
The IUPAC name of 1,1-diethoxy-2,4-di(propan-2-yl)siletane (CID 139888756) is 1,1-diethoxy-2,4-di(propan-2-yl)siletane.
What is the SMILES notation for 1,1-diethoxy-2,4-di(propan-2-yl)siletane?
The canonical SMILES for 1,1-diethoxy-2,4-di(propan-2-yl)siletane is CCO[Si]1(OCC)C(C(C)C)CC1C(C)C.
What is the InChIKey of 1,1-diethoxy-2,4-di(propan-2-yl)siletane?
The InChIKey is BRPKUDWZWWDQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2Si/c1-7-14-16(15-8-2)12(10(3)4)9-13(16)11(5)6/h10-13H,7-9H2,1-6H3.
What are the key properties of 1,1-diethoxy-2,4-di(propan-2-yl)siletane?
1,1-diethoxy-2,4-di(propan-2-yl)siletane has a molecular weight of 244.45 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxy-2,4-di(propan-2-yl)siletane is sourced from PubChem (CID 139888756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).