C6H13NO3 — CID 139888922
(3R,4R)-6-deuterio-6-iminohexane-1,3,4-triol (PubChem CID 139888922) has the molecular formula C6H13NO3 and a molecular weight of 148.18 g/mol. Its IUPAC name is (3R,4R)-6-deuterio-6-iminohexane-1,3,4-triol.
| Compound Name | (3R,4R)-6-deuterio-6-iminohexane-1,3,4-triol |
|---|---|
| PubChem CID | 139888922 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (3R,4R)-6-deuterio-6-iminohexane-1,3,4-triol |
| SMILES | [H]/N=C(\[2H])C[C@@H](O)[C@H](O)CCO |
| InChI | InChI=1S/C6H13NO3/c7-3-1-5(9)6(10)2-4-8/h3,5-10H,1-2,4H2/b7-3+/t5-,6-/m1/s1/i3D |
| InChIKey | PSDGVWARGFMMJJ-OGJWSZIFSA-N |
| XLogP | -0.87 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|