C26H32N3NaO3 — CID 139889755
sodium 2-[4-[[2-(1-benzylpiperidin-2-yl)benzoyl]amino]piperidin-1-yl]acetate (PubChem CID 139889755) has the molecular formula C26H32N3NaO3 and a molecular weight of 457.55 g/mol. Its IUPAC name is sodium 2-[4-[[2-(1-benzylpiperidin-2-yl)benzoyl]amino]piperidin-1-yl]acetate.
| Compound Name | sodium 2-[4-[[2-(1-benzylpiperidin-2-yl)benzoyl]amino]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 139889755 |
| Molecular Formula | C26H32N3NaO3 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | sodium 2-[4-[[2-(1-benzylpiperidin-2-yl)benzoyl]amino]piperidin-1-yl]acetate |
| SMILES | O=C([O-])CN1CCC(NC(=O)c2ccccc2C2CCCCN2Cc2ccccc2)CC1.[Na+] |
| InChI | InChI=1S/C26H33N3O3.Na/c30-25(31)19-28-16-13-21(14-17-28)27-26(32)23-11-5-4-10-22(23)24-12-6-7-15-29(24)18-20-8-2-1-3-9-20;/h1-5,8-11,21,24H,6-7,12-19H2,(H,27,32)(H,30,31);/q;+1/p-1 |
| InChIKey | NOSIRQMSCDEGND-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |