About N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline
N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline (PubChem CID 139889940) has the molecular formula C38H31N5
and a molecular weight of 557.70 g/mol. Its IUPAC name is N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline.
Molecular Properties
| Compound Name | N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline |
| PubChem CID | 139889940 |
| Molecular Formula | C38H31N5 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)n(CN(Cn3nc(-c4ccccc4)cc3-c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C38H31N5/c1-6-16-30(17-7-1)35-26-37(32-20-10-3-11-21-32)42(39-35)28-41(34-24-14-5-15-25-34)29-43-38(33-22-12-4-13-23-33)27-36(40-43)31-18-8-2-9-19-31/h1-27H,28-29H2 |
| InChIKey | OGQWKKSWAPNPFX-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline?
The IUPAC name of N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline (CID 139889940) is N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline.
What is the SMILES notation for N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline?
The canonical SMILES for N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline is c1ccc(-c2cc(-c3ccccc3)n(CN(Cn3nc(-c4ccccc4)cc3-c3ccccc3)c3ccccc3)n2)cc1.
What is the InChIKey of N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline?
The InChIKey is OGQWKKSWAPNPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H31N5/c1-6-16-30(17-7-1)35-26-37(32-20-10-3-11-21-32)42(39-35)28-41(34-24-14-5-15-25-34)29-43-38(33-22-12-4-13-23-33)27-36(40-43)31-18-8-2-9-19-31/h1-27H,28-29H2.
What are the key properties of N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline?
N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline has a molecular weight of 557.70 g/mol, XLogP of 8.87, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[(3,5-diphenylpyrazol-1-yl)methyl]aniline is sourced from PubChem (CID 139889940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).