C37H38N6O6S — CID 139890162
ethyl N-[4-[3-[[2-[3-[(3-methylphenyl)carbamoylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]propyl]phenyl]sulfonylmethanimidate (PubChem CID 139890162) has the molecular formula C37H38N6O6S and a molecular weight of 694.81 g/mol. Its IUPAC name is ethyl N-[4-[3-[[2-[3-[(3-methylphenyl)carbamoylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]propyl]phenyl]sulfonylmethanimidate.
| Compound Name | ethyl N-[4-[3-[[2-[3-[(3-methylphenyl)carbamoylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]propyl]phenyl]sulfonylmethanimidate |
|---|---|
| PubChem CID | 139890162 |
| Molecular Formula | C37H38N6O6S |
| Molecular Weight | 694.81 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | ethyl N-[4-[3-[[2-[3-[(3-methylphenyl)carbamoylamino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]propyl]phenyl]sulfonylmethanimidate |
| SMILES | CCOC=NS(=O)(=O)c1ccc(CCCNC(=O)CN2C(=O)C(NC(=O)Nc3cccc(C)c3)N=C(c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C37H38N6O6S/c1-3-49-25-39-50(47,48)30-20-18-27(19-21-30)12-10-22-38-33(44)24-43-32-17-8-7-16-31(32)34(28-13-5-4-6-14-28)41-35(36(43)45)42-37(46)40-29-15-9-11-26(2)23-29/h4-9,11,13-21,23,25,35H,3,10,12,22,24H2,1-2H3,(H,38,44)(H2,40,42,46) |
| InChIKey | OOMBONJBAIQRHE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 158.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.81 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|