About 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene
1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene (PubChem CID 139890496) has the molecular formula C24H14Cl4O2S
and a molecular weight of 508.25 g/mol. Its IUPAC name is 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene.
Molecular Properties
| Compound Name | 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene |
| PubChem CID | 139890496 |
| Molecular Formula | C24H14Cl4O2S |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 505.95 |
| IUPAC Name | 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene |
| SMILES | O=S(=O)(c1ccccc1-c1cccc(Cl)c1Cl)c1ccccc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H14Cl4O2S/c25-19-11-5-9-17(23(19)27)15-7-1-3-13-21(15)31(29,30)22-14-4-2-8-16(22)18-10-6-12-20(26)24(18)28/h1-14H |
| InChIKey | LSTWPDSOTGGFJB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene?
The IUPAC name of 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene (CID 139890496) is 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene.
What is the SMILES notation for 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene?
The canonical SMILES for 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene is O=S(=O)(c1ccccc1-c1cccc(Cl)c1Cl)c1ccccc1-c1cccc(Cl)c1Cl.
What is the InChIKey of 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene?
The InChIKey is LSTWPDSOTGGFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14Cl4O2S/c25-19-11-5-9-17(23(19)27)15-7-1-3-13-21(15)31(29,30)22-14-4-2-8-16(22)18-10-6-12-20(26)24(18)28/h1-14H.
What are the key properties of 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene?
1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene has a molecular weight of 508.25 g/mol, XLogP of 8.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3-[2-[2-(2,3-dichlorophenyl)phenyl]sulfonylphenyl]benzene is sourced from PubChem (CID 139890496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).