C10H17F3O — CID 139891214
1-(1,2,2-trifluoroethenoxy)octane (PubChem CID 139891214) has the molecular formula C10H17F3O and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethenoxy)octane.
| Compound Name | 1-(1,2,2-trifluoroethenoxy)octane |
|---|---|
| PubChem CID | 139891214 |
| Molecular Formula | C10H17F3O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-(1,2,2-trifluoroethenoxy)octane |
| SMILES | CCCCCCCCOC(F)=C(F)F |
| InChI | InChI=1S/C10H17F3O/c1-2-3-4-5-6-7-8-14-10(13)9(11)12/h2-8H2,1H3 |
| InChIKey | DMKSGSNFJFCXNE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|