C24H51N — CID 139891233
N-ethyl-N,2-dihexyldecan-1-amine (PubChem CID 139891233) has the molecular formula C24H51N and a molecular weight of 353.68 g/mol. Its IUPAC name is N-ethyl-N,2-dihexyldecan-1-amine.
| Compound Name | N-ethyl-N,2-dihexyldecan-1-amine |
|---|---|
| PubChem CID | 139891233 |
| Molecular Formula | C24H51N |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 353.40 |
| IUPAC Name | N-ethyl-N,2-dihexyldecan-1-amine |
| SMILES | CCCCCCCCC(CCCCCC)CN(CC)CCCCCC |
| InChI | InChI=1S/C24H51N/c1-5-9-12-15-16-18-21-24(20-17-13-10-6-2)23-25(8-4)22-19-14-11-7-3/h24H,5-23H2,1-4H3 |
| InChIKey | KWCGNNYMOIOCDB-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|