C26H20N2O2 — CID 139891662
1-benzyl-5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)pyrimidine-2,4-dione (PubChem CID 139891662) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-benzyl-5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139891662 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-benzyl-5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)cc1C1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C26H20N2O2/c29-25-23(17-28(26(30)27-25)16-18-8-2-1-3-9-18)24-21-12-6-4-10-19(21)14-15-20-11-5-7-13-22(20)24/h1-15,17,24H,16H2,(H,27,29,30) |
| InChIKey | WLXDRUGXCUGAJG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|