About 3-propylsulfanyltriazolo[4,5-d]pyrimidine
3-propylsulfanyltriazolo[4,5-d]pyrimidine (PubChem CID 139891675) has the molecular formula C7H9N5S
and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-propylsulfanyltriazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 3-propylsulfanyltriazolo[4,5-d]pyrimidine |
| PubChem CID | 139891675 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-propylsulfanyltriazolo[4,5-d]pyrimidine |
| SMILES | CCCSn1nnc2cncnc21 |
| InChI | InChI=1S/C7H9N5S/c1-2-3-13-12-7-6(10-11-12)4-8-5-9-7/h4-5H,2-3H2,1H3 |
| InChIKey | XQJNEJOOEXYMDQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-propylsulfanyltriazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylsulfanyltriazolo[4,5-d]pyrimidine?
The IUPAC name of 3-propylsulfanyltriazolo[4,5-d]pyrimidine (CID 139891675) is 3-propylsulfanyltriazolo[4,5-d]pyrimidine.
What is the SMILES notation for 3-propylsulfanyltriazolo[4,5-d]pyrimidine?
The canonical SMILES for 3-propylsulfanyltriazolo[4,5-d]pyrimidine is CCCSn1nnc2cncnc21.
What is the InChIKey of 3-propylsulfanyltriazolo[4,5-d]pyrimidine?
The InChIKey is XQJNEJOOEXYMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5S/c1-2-3-13-12-7-6(10-11-12)4-8-5-9-7/h4-5H,2-3H2,1H3.
What are the key properties of 3-propylsulfanyltriazolo[4,5-d]pyrimidine?
3-propylsulfanyltriazolo[4,5-d]pyrimidine has a molecular weight of 195.25 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylsulfanyltriazolo[4,5-d]pyrimidine is sourced from PubChem (CID 139891675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).