About (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol
(1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol (PubChem CID 139891762) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol.
Molecular Properties
| Compound Name | (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol |
| PubChem CID | 139891762 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol |
| SMILES | OCC1CCc2ccccc2N1O |
| InChI | InChI=1S/C10H13NO2/c12-7-9-6-5-8-3-1-2-4-10(8)11(9)13/h1-4,9,12-13H,5-7H2 |
| InChIKey | CTIIONVZCXRJDS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol?
The IUPAC name of (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol (CID 139891762) is (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol.
What is the SMILES notation for (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol?
The canonical SMILES for (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol is OCC1CCc2ccccc2N1O.
What is the InChIKey of (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol?
The InChIKey is CTIIONVZCXRJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c12-7-9-6-5-8-3-1-2-4-10(8)11(9)13/h1-4,9,12-13H,5-7H2.
What are the key properties of (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol?
(1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol has a molecular weight of 179.22 g/mol, XLogP of 1.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-3,4-dihydro-2H-quinolin-2-yl)methanol is sourced from PubChem (CID 139891762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).