C18H18N4O2 — CID 139891765
3-[(2,5-dimethyl-3-pyridinyl)methyl]-1-prop-2-enylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 139891765) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[(2,5-dimethyl-3-pyridinyl)methyl]-1-prop-2-enylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-[(2,5-dimethyl-3-pyridinyl)methyl]-1-prop-2-enylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139891765 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[(2,5-dimethyl-3-pyridinyl)methyl]-1-prop-2-enylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | C=CCn1c(=O)n(Cc2cc(C)cnc2C)c(=O)c2cccnc21 |
| InChI | InChI=1S/C18H18N4O2/c1-4-8-21-16-15(6-5-7-19-16)17(23)22(18(21)24)11-14-9-12(2)10-20-13(14)3/h4-7,9-10H,1,8,11H2,2-3H3 |
| InChIKey | VSFBZADDMPQXAT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|