About 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide
5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 139891932) has the molecular formula C21H19O4P
and a molecular weight of 366.35 g/mol. Its IUPAC name is 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
Molecular Properties
| Compound Name | 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| PubChem CID | 139891932 |
| Molecular Formula | C21H19O4P |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | Cc1cccc(OP2(=O)Oc3ccccc3C(C)c3ccccc3O2)c1 |
| InChI | InChI=1S/C21H19O4P/c1-15-8-7-9-17(14-15)23-26(22)24-20-12-5-3-10-18(20)16(2)19-11-4-6-13-21(19)25-26/h3-14,16H,1-2H3 |
| InChIKey | QQXYSEHHLJXIEA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide?
The IUPAC name of 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (CID 139891932) is 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
What is the SMILES notation for 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide?
The canonical SMILES for 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide is Cc1cccc(OP2(=O)Oc3ccccc3C(C)c3ccccc3O2)c1.
What is the InChIKey of 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide?
The InChIKey is QQXYSEHHLJXIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19O4P/c1-15-8-7-9-17(14-15)23-26(22)24-20-12-5-3-10-18(20)16(2)19-11-4-6-13-21(19)25-26/h3-14,16H,1-2H3.
What are the key properties of 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide?
5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide has a molecular weight of 366.35 g/mol, XLogP of 6.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-11-(3-methylphenoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide is sourced from PubChem (CID 139891932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).