C20H2N8S2 — CID 139892617
5-[(2,3,4,5-tetracyanophenyl)disulfanyl]benzene-1,2,3,4-tetracarbonitrile (PubChem CID 139892617) has the molecular formula C20H2N8S2 and a molecular weight of 418.43 g/mol. Its IUPAC name is 5-[(2,3,4,5-tetracyanophenyl)disulfanyl]benzene-1,2,3,4-tetracarbonitrile.
| Compound Name | 5-[(2,3,4,5-tetracyanophenyl)disulfanyl]benzene-1,2,3,4-tetracarbonitrile |
|---|---|
| PubChem CID | 139892617 |
| Molecular Formula | C20H2N8S2 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 5-[(2,3,4,5-tetracyanophenyl)disulfanyl]benzene-1,2,3,4-tetracarbonitrile |
| SMILES | N#Cc1cc(SSc2cc(C#N)c(C#N)c(C#N)c2C#N)c(C#N)c(C#N)c1C#N |
| InChI | InChI=1S/C20H2N8S2/c21-3-11-1-19(17(9-27)15(7-25)13(11)5-23)29-30-20-2-12(4-22)14(6-24)16(8-26)18(20)10-28/h1-2H |
| InChIKey | IGRROULEKOLFHR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|