C13H7F17O2 — CID 139892651
2-(1-ethenoxyethoxy)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-ene (PubChem CID 139892651) has the molecular formula C13H7F17O2 and a molecular weight of 518.16 g/mol. Its IUPAC name is 2-(1-ethenoxyethoxy)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 2-(1-ethenoxyethoxy)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 139892651 |
| Molecular Formula | C13H7F17O2 |
| Molecular Weight | 518.16 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 2-(1-ethenoxyethoxy)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-ene |
| SMILES | C=COC(C)OC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H7F17O2/c1-3-31-4(2)32-6(9(16,17)18)5(7(14,10(19,20)21)11(22,23)24)8(15,12(25,26)27)13(28,29)30/h3-4H,1H2,2H3 |
| InChIKey | BRPQZUQDXIRZQM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.16 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|