About 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene
3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene (PubChem CID 139892758) has the molecular formula C14H16N2O2S2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene.
Molecular Properties
| Compound Name | 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene |
| PubChem CID | 139892758 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene |
| SMILES | CCCCc1c(N=C=O)c(SC)cc(SC)c1N=C=O |
| InChI | InChI=1S/C14H16N2O2S2/c1-4-5-6-10-13(15-8-17)11(19-2)7-12(20-3)14(10)16-9-18/h7H,4-6H2,1-3H3 |
| InChIKey | VFJIWAOFCWBASX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene?
The IUPAC name of 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene (CID 139892758) is 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene.
What is the SMILES notation for 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene?
The canonical SMILES for 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene is CCCCc1c(N=C=O)c(SC)cc(SC)c1N=C=O.
What is the InChIKey of 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene?
The InChIKey is VFJIWAOFCWBASX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S2/c1-4-5-6-10-13(15-8-17)11(19-2)7-12(20-3)14(10)16-9-18/h7H,4-6H2,1-3H3.
What are the key properties of 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene?
3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene has a molecular weight of 308.43 g/mol, XLogP of 4.41, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2,4-diisocyanato-1,5-bis(methylsulfanyl)benzene is sourced from PubChem (CID 139892758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).