C14H14N2O4 — CID 139893315
ethyl 2-(6-nitro-3-pyridinyl)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 139893315) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 2-(6-nitro-3-pyridinyl)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | ethyl 2-(6-nitro-3-pyridinyl)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 139893315 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl 2-(6-nitro-3-pyridinyl)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc([N+](=O)[O-])nc2)C=CCC1 |
| InChI | InChI=1S/C14H14N2O4/c1-2-20-14(17)12-6-4-3-5-11(12)10-7-8-13(15-9-10)16(18)19/h3,5,7-9H,2,4,6H2,1H3 |
| InChIKey | GCYBRYDPUWVKEW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|