About ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate
ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate (PubChem CID 139893386) has the molecular formula C12H13N3O5S
and a molecular weight of 311.32 g/mol. Its IUPAC name is ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate.
Molecular Properties
| Compound Name | ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate |
| PubChem CID | 139893386 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate |
| SMILES | CCOS(=O)(=O)C1CC=CC=C1c1cnc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C12H13N3O5S/c1-2-20-21(18,19)11-6-4-3-5-10(11)9-7-13-12(14-8-9)15(16)17/h3-5,7-8,11H,2,6H2,1H3 |
| InChIKey | WZRSQCHWQYKOPJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 112.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate?
The IUPAC name of ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate (CID 139893386) is ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate.
What is the SMILES notation for ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate?
The canonical SMILES for ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate is CCOS(=O)(=O)C1CC=CC=C1c1cnc([N+](=O)[O-])nc1.
What is the InChIKey of ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate?
The InChIKey is WZRSQCHWQYKOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O5S/c1-2-20-21(18,19)11-6-4-3-5-10(11)9-7-13-12(14-8-9)15(16)17/h3-5,7-8,11H,2,6H2,1H3.
What are the key properties of ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate?
ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate has a molecular weight of 311.32 g/mol, XLogP of 1.46, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate is sourced from PubChem (CID 139893386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).