About 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile
4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 139893403) has the molecular formula C13H11ClN2O
and a molecular weight of 246.70 g/mol. Its IUPAC name is 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 139893403 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | COc1ccc(C2=C(C#N)CCC(Cl)=C2)cn1 |
| InChI | InChI=1S/C13H11ClN2O/c1-17-13-5-3-10(8-16-13)12-6-11(14)4-2-9(12)7-15/h3,5-6,8H,2,4H2,1H3 |
| InChIKey | HUZWNGVZTPDMHQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile (CID 139893403) is 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile is COc1ccc(C2=C(C#N)CCC(Cl)=C2)cn1.
What is the InChIKey of 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is HUZWNGVZTPDMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O/c1-17-13-5-3-10(8-16-13)12-6-11(14)4-2-9(12)7-15/h3,5-6,8H,2,4H2,1H3.
What are the key properties of 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile?
4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 246.70 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(6-methoxy-3-pyridinyl)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 139893403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).