C20H24F4 — CID 139893704
1,5-bis(1,1-difluoro-2,2-dimethylpropyl)naphthalene (PubChem CID 139893704) has the molecular formula C20H24F4 and a molecular weight of 340.40 g/mol. Its IUPAC name is 1,5-bis(1,1-difluoro-2,2-dimethylpropyl)naphthalene.
| Compound Name | 1,5-bis(1,1-difluoro-2,2-dimethylpropyl)naphthalene |
|---|---|
| PubChem CID | 139893704 |
| Molecular Formula | C20H24F4 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1,5-bis(1,1-difluoro-2,2-dimethylpropyl)naphthalene |
| SMILES | CC(C)(C)C(F)(F)c1cccc2c(C(F)(F)C(C)(C)C)cccc12 |
| InChI | InChI=1S/C20H24F4/c1-17(2,3)19(21,22)15-11-7-10-14-13(15)9-8-12-16(14)20(23,24)18(4,5)6/h7-12H,1-6H3 |
| InChIKey | DWKOWYNXGQGRKQ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |