C36H42FN3OSi — CID 139893762
1-benzyl-4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1-tri(propan-2-yl)silylpyrrol-3-yl]pyridin-4-ol (PubChem CID 139893762) has the molecular formula C36H42FN3OSi and a molecular weight of 579.84 g/mol. Its IUPAC name is 1-benzyl-4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1-tri(propan-2-yl)silylpyrrol-3-yl]pyridin-4-ol.
| Compound Name | 1-benzyl-4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1-tri(propan-2-yl)silylpyrrol-3-yl]pyridin-4-ol |
|---|---|
| PubChem CID | 139893762 |
| Molecular Formula | C36H42FN3OSi |
| Molecular Weight | 579.84 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | 1-benzyl-4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1-tri(propan-2-yl)silylpyrrol-3-yl]pyridin-4-ol |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(C2(O)C=CN(Cc3ccccc3)C=C2)c(-c2ccncc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C36H42FN3OSi/c1-26(2)42(27(3)4,28(5)6)40-25-33(36(41)18-22-39(23-19-36)24-29-10-8-7-9-11-29)34(30-16-20-38-21-17-30)35(40)31-12-14-32(37)15-13-31/h7-23,25-28,41H,24H2,1-6H3 |
| InChIKey | SSSVXMFSLSXHKX-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.84 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|