C18H18FN5O — CID 139893765
2-N-[1-(1-benzofuran-2-yl)ethyl]-6-(1-fluorocyclopent-3-en-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 139893765) has the molecular formula C18H18FN5O and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-N-[1-(1-benzofuran-2-yl)ethyl]-6-(1-fluorocyclopent-3-en-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[1-(1-benzofuran-2-yl)ethyl]-6-(1-fluorocyclopent-3-en-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139893765 |
| Molecular Formula | C18H18FN5O |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-N-[1-(1-benzofuran-2-yl)ethyl]-6-(1-fluorocyclopent-3-en-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Nc1nc(N)nc(C2(F)CC=CC2)n1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H18FN5O/c1-11(14-10-12-6-2-3-7-13(12)25-14)21-17-23-15(22-16(20)24-17)18(19)8-4-5-9-18/h2-7,10-11H,8-9H2,1H3,(H3,20,21,22,23,24) |
| InChIKey | CTSPWOPCTXFMFI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|