About 1H-pyrrolo[3,4-b]pyrrol-2-one
1H-pyrrolo[3,4-b]pyrrol-2-one (PubChem CID 139894694) has the molecular formula C6H4N2O
and a molecular weight of 120.11 g/mol. Its IUPAC name is 1H-pyrrolo[3,4-b]pyrrol-2-one.
Molecular Properties
| Compound Name | 1H-pyrrolo[3,4-b]pyrrol-2-one |
| PubChem CID | 139894694 |
| Molecular Formula | C6H4N2O |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | 1H-pyrrolo[3,4-b]pyrrol-2-one |
| SMILES | O=C1C=C2C=NC=C2N1 |
| InChI | InChI=1S/C6H4N2O/c9-6-1-4-2-7-3-5(4)8-6/h1-3H,(H,8,9) |
| InChIKey | FDAXAOACZIWZAW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrrolo[3,4-b]pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[3,4-b]pyrrol-2-one?
The IUPAC name of 1H-pyrrolo[3,4-b]pyrrol-2-one (CID 139894694) is 1H-pyrrolo[3,4-b]pyrrol-2-one.
What is the SMILES notation for 1H-pyrrolo[3,4-b]pyrrol-2-one?
The canonical SMILES for 1H-pyrrolo[3,4-b]pyrrol-2-one is O=C1C=C2C=NC=C2N1.
What is the InChIKey of 1H-pyrrolo[3,4-b]pyrrol-2-one?
The InChIKey is FDAXAOACZIWZAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O/c9-6-1-4-2-7-3-5(4)8-6/h1-3H,(H,8,9).
What are the key properties of 1H-pyrrolo[3,4-b]pyrrol-2-one?
1H-pyrrolo[3,4-b]pyrrol-2-one has a molecular weight of 120.11 g/mol, XLogP of -0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[3,4-b]pyrrol-2-one is sourced from PubChem (CID 139894694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).