About 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone
2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone (PubChem CID 139895176) has the molecular formula C16H21BrO2S
and a molecular weight of 357.31 g/mol. Its IUPAC name is 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone.
Molecular Properties
| Compound Name | 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone |
| PubChem CID | 139895176 |
| Molecular Formula | C16H21BrO2S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone |
| SMILES | CCCCS(C)(Br)CC(=O)c1ccc2c(C)coc2c1 |
| InChI | InChI=1S/C16H21BrO2S/c1-4-5-8-20(3,17)11-15(18)13-6-7-14-12(2)10-19-16(14)9-13/h6-7,9-10H,4-5,8,11H2,1-3H3 |
| InChIKey | ACDUCYDCEXZLDO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone?
The IUPAC name of 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone (CID 139895176) is 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone.
What is the SMILES notation for 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone?
The canonical SMILES for 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone is CCCCS(C)(Br)CC(=O)c1ccc2c(C)coc2c1.
What is the InChIKey of 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone?
The InChIKey is ACDUCYDCEXZLDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrO2S/c1-4-5-8-20(3,17)11-15(18)13-6-7-14-12(2)10-19-16(14)9-13/h6-7,9-10H,4-5,8,11H2,1-3H3.
What are the key properties of 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone?
2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone has a molecular weight of 357.31 g/mol, XLogP of 5.47, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromo-butyl-methyl-λ4-sulfanyl)-1-(3-methyl-1-benzofuran-6-yl)ethanone is sourced from PubChem (CID 139895176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).