C28H27BrO3 — CID 139895924
1-[3-(1-adamantyl)-5-bromo-4-methoxyphenyl]naphthalene-2-carboxylic acid (PubChem CID 139895924) has the molecular formula C28H27BrO3 and a molecular weight of 491.43 g/mol. Its IUPAC name is 1-[3-(1-adamantyl)-5-bromo-4-methoxyphenyl]naphthalene-2-carboxylic acid.
| Compound Name | 1-[3-(1-adamantyl)-5-bromo-4-methoxyphenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 139895924 |
| Molecular Formula | C28H27BrO3 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 1-[3-(1-adamantyl)-5-bromo-4-methoxyphenyl]naphthalene-2-carboxylic acid |
| SMILES | COc1c(Br)cc(-c2c(C(=O)O)ccc3ccccc23)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H27BrO3/c1-32-26-23(28-13-16-8-17(14-28)10-18(9-16)15-28)11-20(12-24(26)29)25-21-5-3-2-4-19(21)6-7-22(25)27(30)31/h2-7,11-12,16-18H,8-10,13-15H2,1H3,(H,30,31) |
| InChIKey | NQUHCNRAIXNDPE-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |