C17H20Cl2N4O — CID 139896184
2-[2,6-dichloro-3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]quinolin-4-yl]acetamide (PubChem CID 139896184) has the molecular formula C17H20Cl2N4O and a molecular weight of 367.28 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]quinolin-4-yl]acetamide.
| Compound Name | 2-[2,6-dichloro-3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]quinolin-4-yl]acetamide |
|---|---|
| PubChem CID | 139896184 |
| Molecular Formula | C17H20Cl2N4O |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[2,6-dichloro-3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]quinolin-4-yl]acetamide |
| SMILES | C[C@@H]1CN(c2c(Cl)nc3ccc(Cl)cc3c2CC(N)=O)C[C@H](C)N1 |
| InChI | InChI=1S/C17H20Cl2N4O/c1-9-7-23(8-10(2)21-9)16-13(6-15(20)24)12-5-11(18)3-4-14(12)22-17(16)19/h3-5,9-10,21H,6-8H2,1-2H3,(H2,20,24)/t9-,10+ |
| InChIKey | JHNBDURZXVATDH-AOOOYVTPSA-N |
| XLogP | 2.76 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|