C6H10N6O2 — CID 139896213
N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide;hydrate (PubChem CID 139896213) has the molecular formula C6H10N6O2 and a molecular weight of 198.19 g/mol. Its IUPAC name is N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide;hydrate.
| Compound Name | N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide;hydrate |
|---|---|
| PubChem CID | 139896213 |
| Molecular Formula | C6H10N6O2 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide;hydrate |
| SMILES | C=CC(=O)Nc1nc(N)nc(N)n1.O |
| InChI | InChI=1S/C6H8N6O.H2O/c1-2-3(13)9-6-11-4(7)10-5(8)12-6;/h2H,1H2,(H5,7,8,9,10,11,12,13);1H2 |
| InChIKey | YZBMAPAIFWBNKF-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|