C24H28N10O4S3 — CID 139898125
N'-hydroxy-2-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-[2-(2H-tetrazol-5-yl)ethyl]piperazin-1-yl]sulfonyl-1-benzothiophene-5-carboximidamide (PubChem CID 139898125) has the molecular formula C24H28N10O4S3 and a molecular weight of 616.76 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-[2-(2H-tetrazol-5-yl)ethyl]piperazin-1-yl]sulfonyl-1-benzothiophene-5-carboximidamide.
| Compound Name | N'-hydroxy-2-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-[2-(2H-tetrazol-5-yl)ethyl]piperazin-1-yl]sulfonyl-1-benzothiophene-5-carboximidamide |
|---|---|
| PubChem CID | 139898125 |
| Molecular Formula | C24H28N10O4S3 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | N'-hydroxy-2-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-[2-(2H-tetrazol-5-yl)ethyl]piperazin-1-yl]sulfonyl-1-benzothiophene-5-carboximidamide |
| SMILES | CN1CCc2nc(C(=O)N3CCN(S(=O)(=O)c4cc5cc(C(N)=NO)ccc5s4)CC3CCc3nn[nH]n3)sc2C1 |
| InChI | InChI=1S/C24H28N10O4S3/c1-32-7-6-17-19(13-32)40-23(26-17)24(35)34-9-8-33(12-16(34)3-5-20-27-30-31-28-20)41(37,38)21-11-15-10-14(22(25)29-36)2-4-18(15)39-21/h2,4,10-11,16,36H,3,5-9,12-13H2,1H3,(H2,25,29)(H,27,28,30,31) |
| InChIKey | ARPUGPSHRTUNND-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 186.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|