C23H31FN2O4 — CID 139899481
[(4aR,5R,6R,7R)-7-methoxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] 4-fluoropiperidine-1-carboxylate (PubChem CID 139899481) has the molecular formula C23H31FN2O4 and a molecular weight of 418.51 g/mol. Its IUPAC name is [(4aR,5R,6R,7R)-7-methoxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] 4-fluoropiperidine-1-carboxylate.
| Compound Name | [(4aR,5R,6R,7R)-7-methoxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] 4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139899481 |
| Molecular Formula | C23H31FN2O4 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [(4aR,5R,6R,7R)-7-methoxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] 4-fluoropiperidine-1-carboxylate |
| SMILES | CO[C@@H]1C=C2C=C3C(=C(C)C(=O)N3C)C[C@]2(C)[C@@H](C)[C@H]1OC(=O)N1CCC(F)CC1 |
| InChI | InChI=1S/C23H31FN2O4/c1-13-17-12-23(3)14(2)20(30-22(28)26-8-6-16(24)7-9-26)19(29-5)11-15(23)10-18(17)25(4)21(13)27/h10-11,14,16,19-20H,6-9,12H2,1-5H3/t14-,19+,20+,23+/m0/s1 |
| InChIKey | BQNXBSOXOWFRPK-AAAGJGKRSA-N |
| XLogP | 3.60 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |