C20F26 — CID 139900087
1-fluoro-4-[4-fluoro-2,3,5,6-tetrakis(trifluoromethyl)phenyl]-2,3,5,6-tetrakis(trifluoromethyl)benzene (PubChem CID 139900087) has the molecular formula C20F26 and a molecular weight of 734.17 g/mol. Its IUPAC name is 1-fluoro-4-[4-fluoro-2,3,5,6-tetrakis(trifluoromethyl)phenyl]-2,3,5,6-tetrakis(trifluoromethyl)benzene.
| Compound Name | 1-fluoro-4-[4-fluoro-2,3,5,6-tetrakis(trifluoromethyl)phenyl]-2,3,5,6-tetrakis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139900087 |
| Molecular Formula | C20F26 |
| Molecular Weight | 734.17 g/mol |
| Exact Mass | 733.96 |
| IUPAC Name | 1-fluoro-4-[4-fluoro-2,3,5,6-tetrakis(trifluoromethyl)phenyl]-2,3,5,6-tetrakis(trifluoromethyl)benzene |
| SMILES | Fc1c(C(F)(F)F)c(C(F)(F)F)c(-c2c(C(F)(F)F)c(C(F)(F)F)c(F)c(C(F)(F)F)c2C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C20F26/c21-11-7(17(35,36)37)3(13(23,24)25)1(4(14(26,27)28)8(11)18(38,39)40)2-5(15(29,30)31)9(19(41,42)43)12(22)10(20(44,45)46)6(2)16(32,33)34 |
| InChIKey | YTNDENPDIBJJIM-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.17 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |