About 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide
2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide (PubChem CID 139900682) has the molecular formula C21H18F3NOSi
and a molecular weight of 385.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide |
| PubChem CID | 139900682 |
| Molecular Formula | C21H18F3NOSi |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide |
| SMILES | CN(C(=O)C(F)(F)F)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18F3NOSi/c1-25(20(26)21(22,23)24)27(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | WPTWTIQQIMTNCM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide?
The IUPAC name of 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide (CID 139900682) is 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide.
What is the SMILES notation for 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide?
The canonical SMILES for 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide is CN(C(=O)C(F)(F)F)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide?
The InChIKey is WPTWTIQQIMTNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F3NOSi/c1-25(20(26)21(22,23)24)27(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3.
What are the key properties of 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide?
2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide has a molecular weight of 385.46 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-methyl-N-triphenylsilylacetamide is sourced from PubChem (CID 139900682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).