About 1-deuterio-4,5-dimethylimidazolidin-2-one
1-deuterio-4,5-dimethylimidazolidin-2-one (PubChem CID 139901387) has the molecular formula C5H10N2O
and a molecular weight of 115.15 g/mol. Its IUPAC name is 1-deuterio-4,5-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-deuterio-4,5-dimethylimidazolidin-2-one |
| PubChem CID | 139901387 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | 1-deuterio-4,5-dimethylimidazolidin-2-one |
| SMILES | [2H]N1C(=O)NC(C)C1C |
| InChI | InChI=1S/C5H10N2O/c1-3-4(2)7-5(8)6-3/h3-4H,1-2H3,(H2,6,7,8)/i/hD |
| InChIKey | FEVSXQMJLWVHDA-DYCDLGHISA-N |
| XLogP | 0.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-deuterio-4,5-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-4,5-dimethylimidazolidin-2-one?
The IUPAC name of 1-deuterio-4,5-dimethylimidazolidin-2-one (CID 139901387) is 1-deuterio-4,5-dimethylimidazolidin-2-one.
What is the SMILES notation for 1-deuterio-4,5-dimethylimidazolidin-2-one?
The canonical SMILES for 1-deuterio-4,5-dimethylimidazolidin-2-one is [2H]N1C(=O)NC(C)C1C.
What is the InChIKey of 1-deuterio-4,5-dimethylimidazolidin-2-one?
The InChIKey is FEVSXQMJLWVHDA-DYCDLGHISA-N. The full InChI is InChI=1S/C5H10N2O/c1-3-4(2)7-5(8)6-3/h3-4H,1-2H3,(H2,6,7,8)/i/hD.
What are the key properties of 1-deuterio-4,5-dimethylimidazolidin-2-one?
1-deuterio-4,5-dimethylimidazolidin-2-one has a molecular weight of 115.15 g/mol, XLogP of 0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-4,5-dimethylimidazolidin-2-one is sourced from PubChem (CID 139901387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).