C24H15F12N — CID 139901879
2,4-bis[[3,5-bis(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 139901879) has the molecular formula C24H15F12N and a molecular weight of 545.37 g/mol. Its IUPAC name is 2,4-bis[[3,5-bis(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 2,4-bis[[3,5-bis(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 139901879 |
| Molecular Formula | C24H15F12N |
| Molecular Weight | 545.37 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 2,4-bis[[3,5-bis(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | Nc1ccc(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H15F12N/c25-21(26,27)16-6-13(7-17(10-16)22(28,29)30)3-12-1-2-20(37)15(4-12)5-14-8-18(23(31,32)33)11-19(9-14)24(34,35)36/h1-2,4,6-11H,3,5,37H2 |
| InChIKey | CBJVOCXUFZMPDA-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.37 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|