About 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline
2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline (PubChem CID 139901907) has the molecular formula C14H9F6NO2S
and a molecular weight of 369.29 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline |
| PubChem CID | 139901907 |
| Molecular Formula | C14H9F6NO2S |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline |
| SMILES | Nc1ccccc1S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F6NO2S/c15-13(16,17)8-5-9(14(18,19)20)7-10(6-8)24(22,23)12-4-2-1-3-11(12)21/h1-7H,21H2 |
| InChIKey | AZDUXVKWKCCADD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline (CID 139901907) is 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline is Nc1ccccc1S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline?
The InChIKey is AZDUXVKWKCCADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F6NO2S/c15-13(16,17)8-5-9(14(18,19)20)7-10(6-8)24(22,23)12-4-2-1-3-11(12)21/h1-7H,21H2.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline?
2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline has a molecular weight of 369.29 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylaniline is sourced from PubChem (CID 139901907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).