About propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride
propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride (PubChem CID 139902154) has the molecular formula C16H29ClN2O2
and a molecular weight of 316.87 g/mol. Its IUPAC name is propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride |
| PubChem CID | 139902154 |
| Molecular Formula | C16H29ClN2O2 |
| Molecular Weight | 316.87 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride |
| SMILES | C=C1CCC(N(C(=O)OC(C)C)C2CCNCC2)CC1.Cl |
| InChI | InChI=1S/C16H28N2O2.ClH/c1-12(2)20-16(19)18(15-8-10-17-11-9-15)14-6-4-13(3)5-7-14;/h12,14-15,17H,3-11H2,1-2H3;1H |
| InChIKey | IWVGJDNJSCWYNV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride?
The IUPAC name of propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride (CID 139902154) is propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride.
What is the SMILES notation for propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride?
The canonical SMILES for propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride is C=C1CCC(N(C(=O)OC(C)C)C2CCNCC2)CC1.Cl.
What is the InChIKey of propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride?
The InChIKey is IWVGJDNJSCWYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O2.ClH/c1-12(2)20-16(19)18(15-8-10-17-11-9-15)14-6-4-13(3)5-7-14;/h12,14-15,17H,3-11H2,1-2H3;1H.
What are the key properties of propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride?
propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride has a molecular weight of 316.87 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(4-methylidenecyclohexyl)-N-piperidin-4-ylcarbamate;hydrochloride is sourced from PubChem (CID 139902154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).