About 1,2-dibutoxyoct-1-en-1-ol
1,2-dibutoxyoct-1-en-1-ol (PubChem CID 139902412) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is 1,2-dibutoxyoct-1-en-1-ol.
Molecular Properties
| Compound Name | 1,2-dibutoxyoct-1-en-1-ol |
| PubChem CID | 139902412 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 1,2-dibutoxyoct-1-en-1-ol |
| SMILES | CCCCCCC(OCCCC)=C(O)OCCCC |
| InChI | InChI=1S/C16H32O3/c1-4-7-10-11-12-15(18-13-8-5-2)16(17)19-14-9-6-3/h17H,4-14H2,1-3H3 |
| InChIKey | CKGAWUHTGCKVIV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibutoxyoct-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibutoxyoct-1-en-1-ol?
The IUPAC name of 1,2-dibutoxyoct-1-en-1-ol (CID 139902412) is 1,2-dibutoxyoct-1-en-1-ol.
What is the SMILES notation for 1,2-dibutoxyoct-1-en-1-ol?
The canonical SMILES for 1,2-dibutoxyoct-1-en-1-ol is CCCCCCC(OCCCC)=C(O)OCCCC.
What is the InChIKey of 1,2-dibutoxyoct-1-en-1-ol?
The InChIKey is CKGAWUHTGCKVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-4-7-10-11-12-15(18-13-8-5-2)16(17)19-14-9-6-3/h17H,4-14H2,1-3H3.
What are the key properties of 1,2-dibutoxyoct-1-en-1-ol?
1,2-dibutoxyoct-1-en-1-ol has a molecular weight of 272.43 g/mol, XLogP of 5.32, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibutoxyoct-1-en-1-ol is sourced from PubChem (CID 139902412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).