About 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane
2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane (PubChem CID 139902968) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane.
Molecular Properties
| Compound Name | 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane |
| PubChem CID | 139902968 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane |
| SMILES | C(C=COCC1CO1)=COCC1CO1 |
| InChI | InChI=1S/C10H14O4/c1(3-11-5-9-7-13-9)2-4-12-6-10-8-14-10/h1-4,9-10H,5-8H2 |
| InChIKey | ZZQZRZQLAWFPAG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane?
The IUPAC name of 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane (CID 139902968) is 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane.
What is the SMILES notation for 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane?
The canonical SMILES for 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane is C(C=COCC1CO1)=COCC1CO1.
What is the InChIKey of 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane?
The InChIKey is ZZQZRZQLAWFPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1(3-11-5-9-7-13-9)2-4-12-6-10-8-14-10/h1-4,9-10H,5-8H2.
What are the key properties of 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane?
2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane has a molecular weight of 198.22 g/mol, XLogP of 0.84, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(oxiran-2-ylmethoxy)buta-1,3-dienoxymethyl]oxirane is sourced from PubChem (CID 139902968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).