C11H9I — CID 139903095
1-iodotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 139903095) has the molecular formula C11H9I and a molecular weight of 268.10 g/mol. Its IUPAC name is 1-iodotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | 1-iodotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 139903095 |
| Molecular Formula | C11H9I |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 1-iodotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | IC12C=CC(C1)c1ccccc12 |
| InChI | InChI=1S/C11H9I/c12-11-6-5-8(7-11)9-3-1-2-4-10(9)11/h1-6,8H,7H2 |
| InChIKey | ZAYXHZZOEXIFHD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|