About 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate
1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate (PubChem CID 139903606) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate.
Molecular Properties
| Compound Name | 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate |
| PubChem CID | 139903606 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate |
| SMILES | CCCCOC(=O)/C(C)=C\C(=O)OCC(C)=O |
| InChI | InChI=1S/C12H18O5/c1-4-5-6-16-12(15)9(2)7-11(14)17-8-10(3)13/h7H,4-6,8H2,1-3H3/b9-7- |
| InChIKey | GPRWEJFIWFAUEL-CLFYSBASSA-N |
| XLogP | 1.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate?
The IUPAC name of 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate (CID 139903606) is 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate.
What is the SMILES notation for 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate?
The canonical SMILES for 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate is CCCCOC(=O)/C(C)=C\C(=O)OCC(C)=O.
What is the InChIKey of 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate?
The InChIKey is GPRWEJFIWFAUEL-CLFYSBASSA-N. The full InChI is InChI=1S/C12H18O5/c1-4-5-6-16-12(15)9(2)7-11(14)17-8-10(3)13/h7H,4-6,8H2,1-3H3/b9-7-.
What are the key properties of 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate?
1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate has a molecular weight of 242.27 g/mol, XLogP of 1.41, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-butyl 4-O-(2-oxopropyl) (Z)-2-methylbut-2-enedioate is sourced from PubChem (CID 139903606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).