About bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate
bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate (PubChem CID 139903679) has the molecular formula C17H26O8
and a molecular weight of 358.39 g/mol. Its IUPAC name is bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate.
Molecular Properties
| Compound Name | bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate |
| PubChem CID | 139903679 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate |
| SMILES | CCCCOC(=O)COC(=O)/C=C(/C)C(=O)OCC(=O)OCCCC |
| InChI | InChI=1S/C17H26O8/c1-4-6-8-22-15(19)11-24-14(18)10-13(3)17(21)25-12-16(20)23-9-7-5-2/h10H,4-9,11-12H2,1-3H3/b13-10- |
| InChIKey | GJTDLMGVJMIWER-RAXLEYEMSA-N |
| XLogP | 1.71 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate?
The IUPAC name of bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate (CID 139903679) is bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate.
What is the SMILES notation for bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate?
The canonical SMILES for bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate is CCCCOC(=O)COC(=O)/C=C(/C)C(=O)OCC(=O)OCCCC.
What is the InChIKey of bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate?
The InChIKey is GJTDLMGVJMIWER-RAXLEYEMSA-N. The full InChI is InChI=1S/C17H26O8/c1-4-6-8-22-15(19)11-24-14(18)10-13(3)17(21)25-12-16(20)23-9-7-5-2/h10H,4-9,11-12H2,1-3H3/b13-10-.
What are the key properties of bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate?
bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate has a molecular weight of 358.39 g/mol, XLogP of 1.71, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butoxy-2-oxoethyl) (Z)-2-methylbut-2-enedioate is sourced from PubChem (CID 139903679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).