C19H19NO6S — CID 139903794
methyl (1S,2S,3aR,8bS)-1-(benzenesulfonamido)-2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-carboxylate (PubChem CID 139903794) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl (1S,2S,3aR,8bS)-1-(benzenesulfonamido)-2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-carboxylate.
| Compound Name | methyl (1S,2S,3aR,8bS)-1-(benzenesulfonamido)-2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 139903794 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | methyl (1S,2S,3aR,8bS)-1-(benzenesulfonamido)-2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-carboxylate |
| SMILES | COC(=O)c1cccc2c1O[C@@H]1C[C@H](O)[C@@H](NS(=O)(=O)c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C19H19NO6S/c1-25-19(22)13-9-5-8-12-16-15(26-18(12)13)10-14(21)17(16)20-27(23,24)11-6-3-2-4-7-11/h2-9,14-17,20-21H,10H2,1H3/t14-,15+,16+,17+/m0/s1 |
| InChIKey | KMAPRAYIASUMFS-YLFCFFPRSA-N |
| XLogP | 1.43 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |