C17H23NO4 — CID 139904625
trans-[(1S)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (1R,3S)-3-[(Z)-methoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 139904625) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is trans-[(1S)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (1R,3S)-3-[(Z)-methoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[(1S)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (1R,3S)-3-[(Z)-methoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139904625 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | trans-[(1S)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (1R,3S)-3-[(Z)-methoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C=CCC1=C(C)[C@@H](OC(=O)[C@@H]2[C@H](/C=N\OC)C2(C)C)CC1=O |
| InChI | InChI=1S/C17H23NO4/c1-6-7-11-10(2)14(8-13(11)19)22-16(20)15-12(9-18-21-5)17(15,3)4/h6,9,12,14-15H,1,7-8H2,2-5H3/b18-9-/t12-,14-,15-/m0/s1 |
| InChIKey | BJCVGVKHWCDWHQ-BRSRRXNVSA-N |
| XLogP | 2.67 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|